C19H29NO3S — CID 98786738
(Z)-3-(1-adamantyl)-N-[[(3S)-1,1-dioxothiolan-3-yl]methyl]but-2-enamide (PubChem CID 98786738) has the molecular formula C19H29NO3S and a molecular weight of 351.51 g/mol. Its IUPAC name is (Z)-3-(1-adamantyl)-N-[[(3S)-1,1-dioxothiolan-3-yl]methyl]but-2-enamide.
| Compound Name | (Z)-3-(1-adamantyl)-N-[[(3S)-1,1-dioxothiolan-3-yl]methyl]but-2-enamide |
|---|---|
| PubChem CID | 98786738 |
| Molecular Formula | C19H29NO3S |
| Molecular Weight | 351.51 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | (Z)-3-(1-adamantyl)-N-[[(3S)-1,1-dioxothiolan-3-yl]methyl]but-2-enamide |
| SMILES | C/C(=C/C(=O)NC[C@@H]1CCS(=O)(=O)C1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C19H29NO3S/c1-13(4-18(21)20-11-14-2-3-24(22,23)12-14)19-8-15-5-16(9-19)7-17(6-15)10-19/h4,14-17H,2-3,5-12H2,1H3,(H,20,21)/b13-4-/t14-,15?,16?,17?,19?/m0/s1 |
| InChIKey | RCHSCKBWTMQBRT-VBHJYVLPSA-N |
| XLogP | 2.70 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.51 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|