C12H18O3Si — CID 11020968
(1S,3S)-1-(furan-3-yl)-5-trimethylsilylpent-4-yne-1,3-diol (PubChem CID 11020968) has the molecular formula C12H18O3Si and a molecular weight of 238.36 g/mol. Its IUPAC name is (1S,3S)-1-(furan-3-yl)-5-trimethylsilylpent-4-yne-1,3-diol.
| Compound Name | (1S,3S)-1-(furan-3-yl)-5-trimethylsilylpent-4-yne-1,3-diol |
|---|---|
| PubChem CID | 11020968 |
| Molecular Formula | C12H18O3Si |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | (1S,3S)-1-(furan-3-yl)-5-trimethylsilylpent-4-yne-1,3-diol |
| SMILES | C[Si](C)(C)C#C[C@@H](O)C[C@H](O)c1ccoc1 |
| InChI | InChI=1S/C12H18O3Si/c1-16(2,3)7-5-11(13)8-12(14)10-4-6-15-9-10/h4,6,9,11-14H,8H2,1-3H3/t11-,12+/m1/s1 |
| InChIKey | QTRODEBLWSPZSG-NEPJUHHUSA-N |
| XLogP | 1.94 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|