C19H17N — CID 11021600
9-phenyl-1,2,3,4-tetrahydroacridine (PubChem CID 11021600) has the molecular formula C19H17N and a molecular weight of 259.35 g/mol. Its IUPAC name is 9-phenyl-1,2,3,4-tetrahydroacridine.
| Compound Name | 9-phenyl-1,2,3,4-tetrahydroacridine |
|---|---|
| PubChem CID | 11021600 |
| Molecular Formula | C19H17N |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 9-phenyl-1,2,3,4-tetrahydroacridine |
| SMILES | c1ccc(-c2c3c(nc4ccccc24)CCCC3)cc1 |
| InChI | InChI=1S/C19H17N/c1-2-8-14(9-3-1)19-15-10-4-6-12-17(15)20-18-13-7-5-11-16(18)19/h1-4,6,8-10,12H,5,7,11,13H2 |
| InChIKey | KVWQMXDWBOKOIH-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |