C17H17ClF2N2O3 — CID 1102235
1-(2-chloro-4,5-difluorophenyl)-3-[2-(3,4-dimethoxyphenyl)ethyl]urea (PubChem CID 1102235) has the molecular formula C17H17ClF2N2O3 and a molecular weight of 370.78 g/mol. Its IUPAC name is 1-(2-chloro-4,5-difluorophenyl)-3-[2-(3,4-dimethoxyphenyl)ethyl]urea.
| Compound Name | 1-(2-chloro-4,5-difluorophenyl)-3-[2-(3,4-dimethoxyphenyl)ethyl]urea |
|---|---|
| PubChem CID | 1102235 |
| Molecular Formula | C17H17ClF2N2O3 |
| Molecular Weight | 370.78 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | 1-(2-chloro-4,5-difluorophenyl)-3-[2-(3,4-dimethoxyphenyl)ethyl]urea |
| SMILES | COc1ccc(CCNC(=O)Nc2cc(F)c(F)cc2Cl)cc1OC |
| InChI | InChI=1S/C17H17ClF2N2O3/c1-24-15-4-3-10(7-16(15)25-2)5-6-21-17(23)22-14-9-13(20)12(19)8-11(14)18/h3-4,7-9H,5-6H2,1-2H3,(H2,21,22,23) |
| InChIKey | SUVGXZLAGWPTDN-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.78 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|