C25H27N5O3 — CID 110229905
6-[[4-(4-methoxyphenyl)phenyl]methyl]-4-prop-2-enyl-1-(1H-1,2,4-triazole-5-carbonyl)-1,4-diazepan-5-one (PubChem CID 110229905) has the molecular formula C25H27N5O3 and a molecular weight of 445.52 g/mol. Its IUPAC name is 6-[[4-(4-methoxyphenyl)phenyl]methyl]-4-prop-2-enyl-1-(1H-1,2,4-triazole-5-carbonyl)-1,4-diazepan-5-one.
| Compound Name | 6-[[4-(4-methoxyphenyl)phenyl]methyl]-4-prop-2-enyl-1-(1H-1,2,4-triazole-5-carbonyl)-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 110229905 |
| Molecular Formula | C25H27N5O3 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | 6-[[4-(4-methoxyphenyl)phenyl]methyl]-4-prop-2-enyl-1-(1H-1,2,4-triazole-5-carbonyl)-1,4-diazepan-5-one |
| SMILES | C=CCN1CCN(C(=O)c2ncn[nH]2)CC(Cc2ccc(-c3ccc(OC)cc3)cc2)C1=O |
| InChI | InChI=1S/C25H27N5O3/c1-3-12-29-13-14-30(25(32)23-26-17-27-28-23)16-21(24(29)31)15-18-4-6-19(7-5-18)20-8-10-22(33-2)11-9-20/h3-11,17,21H,1,12-16H2,2H3,(H,26,27,28) |
| InChIKey | WDASXTIGFXGXLU-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|