C11H22NO+ — CID 11023335
(4aS,5R,8aS)-1,1-dimethyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ium-5-ol (PubChem CID 11023335) has the molecular formula C11H22NO+ and a molecular weight of 184.30 g/mol. Its IUPAC name is (4aS,5R,8aS)-1,1-dimethyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ium-5-ol.
| Compound Name | (4aS,5R,8aS)-1,1-dimethyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ium-5-ol |
|---|---|
| PubChem CID | 11023335 |
| Molecular Formula | C11H22NO+ |
| Molecular Weight | 184.30 g/mol |
| Exact Mass | 184.17 |
| IUPAC Name | (4aS,5R,8aS)-1,1-dimethyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ium-5-ol |
| SMILES | C[N+]1(C)CCC[C@@H]2[C@H](O)CCC[C@@H]21 |
| InChI | InChI=1S/C11H22NO/c1-12(2)8-4-5-9-10(12)6-3-7-11(9)13/h9-11,13H,3-8H2,1-2H3/q+1/t9-,10-,11+/m0/s1 |
| InChIKey | AYAOFMNYEQAWFM-GARJFASQSA-N |
| XLogP | 1.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.30 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|