C15H28NO+ — CID 23826070
(9R)-2-(1-methylpiperidin-1-ium-1-yl)bicyclo[3.3.1]nonan-9-ol (PubChem CID 23826070) has the molecular formula C15H28NO+ and a molecular weight of 238.39 g/mol. Its IUPAC name is (9R)-2-(1-methylpiperidin-1-ium-1-yl)bicyclo[3.3.1]nonan-9-ol.
| Compound Name | (9R)-2-(1-methylpiperidin-1-ium-1-yl)bicyclo[3.3.1]nonan-9-ol |
|---|---|
| PubChem CID | 23826070 |
| Molecular Formula | C15H28NO+ |
| Molecular Weight | 238.39 g/mol |
| Exact Mass | 238.22 |
| IUPAC Name | (9R)-2-(1-methylpiperidin-1-ium-1-yl)bicyclo[3.3.1]nonan-9-ol |
| SMILES | C[N+]1(C2CCC3CCCC2[C@@H]3O)CCCCC1 |
| InChI | InChI=1S/C15H28NO/c1-16(10-3-2-4-11-16)14-9-8-12-6-5-7-13(14)15(12)17/h12-15,17H,2-11H2,1H3/q+1/t12?,13?,14?,15-/m1/s1 |
| InChIKey | IMXNJBZKYVFTKA-MLGYPOCJSA-N |
| XLogP | 2.56 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.39 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|