C12H22INO — CID 163331066
1-methyl-1-azoniatricyclo[6.2.2.02,7]dodecan-5-ol iodide (PubChem CID 163331066) has the molecular formula C12H22INO and a molecular weight of 323.22 g/mol. Its IUPAC name is 1-methyl-1-azoniatricyclo[6.2.2.02,7]dodecan-5-ol iodide.
| Compound Name | 1-methyl-1-azoniatricyclo[6.2.2.02,7]dodecan-5-ol iodide |
|---|---|
| PubChem CID | 163331066 |
| Molecular Formula | C12H22INO |
| Molecular Weight | 323.22 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | 1-methyl-1-azoniatricyclo[6.2.2.02,7]dodecan-5-ol iodide |
| SMILES | C[N+]12CCC(CC1)C1CC(O)CCC12.[I-] |
| InChI | InChI=1S/C12H22NO.HI/c1-13-6-4-9(5-7-13)11-8-10(14)2-3-12(11)13;/h9-12,14H,2-8H2,1H3;1H/q+1;/p-1 |
| InChIKey | CKLGGQZAGMSODI-UHFFFAOYSA-M |
| XLogP | -1.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.22 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|