C11H22N+ — CID 20676418
1,1-dimethyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ium (PubChem CID 20676418) has the molecular formula C11H22N+ and a molecular weight of 168.30 g/mol. Its IUPAC name is 1,1-dimethyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ium.
| Compound Name | 1,1-dimethyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ium |
|---|---|
| PubChem CID | 20676418 |
| Molecular Formula | C11H22N+ |
| Molecular Weight | 168.30 g/mol |
| Exact Mass | 168.17 |
| IUPAC Name | 1,1-dimethyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ium |
| SMILES | C[N+]1(C)CCCC2CCCCC21 |
| InChI | InChI=1S/C11H22N/c1-12(2)9-5-7-10-6-3-4-8-11(10)12/h10-11H,3-9H2,1-2H3/q+1 |
| InChIKey | LVTXTVWKBOOKOQ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.30 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|