C11H22Cl2NSi+ — CID 173270943
dichloro-(1-propyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-ium-1-yl)silane (PubChem CID 173270943) has the molecular formula C11H22Cl2NSi+ and a molecular weight of 267.30 g/mol. Its IUPAC name is dichloro-(1-propyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-ium-1-yl)silane.
| Compound Name | dichloro-(1-propyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-ium-1-yl)silane |
|---|---|
| PubChem CID | 173270943 |
| Molecular Formula | C11H22Cl2NSi+ |
| Molecular Weight | 267.30 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | dichloro-(1-propyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-ium-1-yl)silane |
| SMILES | CCC[N+]1([SiH](Cl)Cl)CCC2CCCCC21 |
| InChI | InChI=1S/C11H22Cl2NSi/c1-2-8-14(15(12)13)9-7-10-5-3-4-6-11(10)14/h10-11,15H,2-9H2,1H3/q+1 |
| InChIKey | BFZUPJITJAKVIV-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.30 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|