C11H19IN2 — CID 52994093
(1R,9aR)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-carbonitrile iodide (PubChem CID 52994093) has the molecular formula C11H19IN2 and a molecular weight of 306.19 g/mol. Its IUPAC name is (1R,9aR)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-carbonitrile iodide.
| Compound Name | (1R,9aR)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-carbonitrile iodide |
|---|---|
| PubChem CID | 52994093 |
| Molecular Formula | C11H19IN2 |
| Molecular Weight | 306.19 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | (1R,9aR)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-carbonitrile iodide |
| SMILES | C[N+]12CCCC[C@@H]1[C@H](C#N)CCC2.[I-] |
| InChI | InChI=1S/C11H19N2.HI/c1-13-7-3-2-6-11(13)10(9-12)5-4-8-13;/h10-11H,2-8H2,1H3;1H/q+1;/p-1/t10-,11+,13?;/m0./s1 |
| InChIKey | DZXPHSDBPPAKGY-DGKOSOBHSA-M |
| XLogP | -1.08 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.19 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|