C11H19N2+ — CID 3454607
5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-carbonitrile (PubChem CID 3454607) has the molecular formula C11H19N2+ and a molecular weight of 179.29 g/mol. Its IUPAC name is 5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-carbonitrile.
| Compound Name | 5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-carbonitrile |
|---|---|
| PubChem CID | 3454607 |
| Molecular Formula | C11H19N2+ |
| Molecular Weight | 179.29 g/mol |
| Exact Mass | 179.15 |
| IUPAC Name | 5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-carbonitrile |
| SMILES | C[N+]12CCCCC1C(C#N)CCC2 |
| InChI | InChI=1S/C11H19N2/c1-13-7-3-2-6-11(13)10(9-12)5-4-8-13/h10-11H,2-8H2,1H3/q+1 |
| InChIKey | LPETYMAKMFRORA-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.29 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|