C14H23N2O2+ — CID 129425909
1-[(1S,5R,9aS)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]pyrrolidine-2,5-dione (PubChem CID 129425909) has the molecular formula C14H23N2O2+ and a molecular weight of 251.35 g/mol. Its IUPAC name is 1-[(1S,5R,9aS)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]pyrrolidine-2,5-dione.
| Compound Name | 1-[(1S,5R,9aS)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 129425909 |
| Molecular Formula | C14H23N2O2+ |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.18 |
| IUPAC Name | 1-[(1S,5R,9aS)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]pyrrolidine-2,5-dione |
| SMILES | C[N@+]12CCCC[C@H]1[C@@H](N1C(=O)CCC1=O)CCC2 |
| InChI | InChI=1S/C14H23N2O2/c1-16-9-3-2-6-12(16)11(5-4-10-16)15-13(17)7-8-14(15)18/h11-12H,2-10H2,1H3/q+1/t11-,12-,16+/m0/s1 |
| InChIKey | MYYOGQZKFKTQSS-MQIPJXDCSA-N |
| XLogP | 1.30 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|