C20H29NO2 — CID 11023482
2-benzyl-N,5-dimethyl-N-(3-methylbut-2-enoxy)hex-4-enamide (PubChem CID 11023482) has the molecular formula C20H29NO2 and a molecular weight of 315.46 g/mol. Its IUPAC name is 2-benzyl-N,5-dimethyl-N-(3-methylbut-2-enoxy)hex-4-enamide.
| Compound Name | 2-benzyl-N,5-dimethyl-N-(3-methylbut-2-enoxy)hex-4-enamide |
|---|---|
| PubChem CID | 11023482 |
| Molecular Formula | C20H29NO2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | 2-benzyl-N,5-dimethyl-N-(3-methylbut-2-enoxy)hex-4-enamide |
| SMILES | CC(C)=CCON(C)C(=O)C(CC=C(C)C)Cc1ccccc1 |
| InChI | InChI=1S/C20H29NO2/c1-16(2)11-12-19(15-18-9-7-6-8-10-18)20(22)21(5)23-14-13-17(3)4/h6-11,13,19H,12,14-15H2,1-5H3 |
| InChIKey | OROUFQMVAZJWOY-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|