About 1-acetyl-N-[1-(1,5-dimethylpyrazol-4-yl)ethyl]azetidine-3-carboxamide
1-acetyl-N-[1-(1,5-dimethylpyrazol-4-yl)ethyl]azetidine-3-carboxamide (PubChem CID 110246346) has the molecular formula C13H20N4O2
and a molecular weight of 264.33 g/mol. Its IUPAC name is 1-acetyl-N-[1-(1,5-dimethylpyrazol-4-yl)ethyl]azetidine-3-carboxamide.
Molecular Properties
| Compound Name | 1-acetyl-N-[1-(1,5-dimethylpyrazol-4-yl)ethyl]azetidine-3-carboxamide |
| PubChem CID | 110246346 |
| Molecular Formula | C13H20N4O2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 1-acetyl-N-[1-(1,5-dimethylpyrazol-4-yl)ethyl]azetidine-3-carboxamide |
| SMILES | CC(=O)N1CC(C(=O)NC(C)c2cnn(C)c2C)C1 |
| InChI | InChI=1S/C13H20N4O2/c1-8(12-5-14-16(4)9(12)2)15-13(19)11-6-17(7-11)10(3)18/h5,8,11H,6-7H2,1-4H3,(H,15,19) |
| InChIKey | XFJIVUKTFRKDPQ-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-acetyl-N-[1-(1,5-dimethylpyrazol-4-yl)ethyl]azetidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-acetyl-N-[1-(1,5-dimethylpyrazol-4-yl)ethyl]azetidine-3-carboxamide?
The IUPAC name of 1-acetyl-N-[1-(1,5-dimethylpyrazol-4-yl)ethyl]azetidine-3-carboxamide (CID 110246346) is 1-acetyl-N-[1-(1,5-dimethylpyrazol-4-yl)ethyl]azetidine-3-carboxamide.
What is the SMILES notation for 1-acetyl-N-[1-(1,5-dimethylpyrazol-4-yl)ethyl]azetidine-3-carboxamide?
The canonical SMILES for 1-acetyl-N-[1-(1,5-dimethylpyrazol-4-yl)ethyl]azetidine-3-carboxamide is CC(=O)N1CC(C(=O)NC(C)c2cnn(C)c2C)C1.
What is the InChIKey of 1-acetyl-N-[1-(1,5-dimethylpyrazol-4-yl)ethyl]azetidine-3-carboxamide?
The InChIKey is XFJIVUKTFRKDPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N4O2/c1-8(12-5-14-16(4)9(12)2)15-13(19)11-6-17(7-11)10(3)18/h5,8,11H,6-7H2,1-4H3,(H,15,19).
What are the key properties of 1-acetyl-N-[1-(1,5-dimethylpyrazol-4-yl)ethyl]azetidine-3-carboxamide?
1-acetyl-N-[1-(1,5-dimethylpyrazol-4-yl)ethyl]azetidine-3-carboxamide has a molecular weight of 264.33 g/mol, XLogP of 0.38, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-acetyl-N-[1-(1,5-dimethylpyrazol-4-yl)ethyl]azetidine-3-carboxamide is sourced from PubChem (CID 110246346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).