C17H21NO6S — CID 11024980
ethyl (3R,6S,7R,8S,8aS)-6,7-dihydroxy-5-oxo-8-phenylmethoxy-2,3,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]pyridine-3-carboxylate (PubChem CID 11024980) has the molecular formula C17H21NO6S and a molecular weight of 367.42 g/mol. Its IUPAC name is ethyl (3R,6S,7R,8S,8aS)-6,7-dihydroxy-5-oxo-8-phenylmethoxy-2,3,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]pyridine-3-carboxylate.
| Compound Name | ethyl (3R,6S,7R,8S,8aS)-6,7-dihydroxy-5-oxo-8-phenylmethoxy-2,3,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 11024980 |
| Molecular Formula | C17H21NO6S |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | ethyl (3R,6S,7R,8S,8aS)-6,7-dihydroxy-5-oxo-8-phenylmethoxy-2,3,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]pyridine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CS[C@H]2[C@@H](OCc3ccccc3)[C@H](O)[C@H](O)C(=O)N12 |
| InChI | InChI=1S/C17H21NO6S/c1-2-23-17(22)11-9-25-16-14(12(19)13(20)15(21)18(11)16)24-8-10-6-4-3-5-7-10/h3-7,11-14,16,19-20H,2,8-9H2,1H3/t11-,12+,13-,14-,16-/m0/s1 |
| InChIKey | ZNPWYQMDHTYPQH-RGHULWKBSA-N |
| XLogP | 0.14 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |