C32H24 — CID 11025931
pentacyclo[23.3.1.14,8.111,15.118,22]dotriaconta-1(29),2,4(32),5,7,9,11(31),12,14,16,18,20,22(30),23,25,27-hexadecaene (PubChem CID 11025931) has the molecular formula C32H24 and a molecular weight of 408.54 g/mol. Its IUPAC name is pentacyclo[23.3.1.14,8.111,15.118,22]dotriaconta-1(29),2,4(32),5,7,9,11(31),12,14,16,18,20,22(30),23,25,27-hexadecaene.
| Compound Name | pentacyclo[23.3.1.14,8.111,15.118,22]dotriaconta-1(29),2,4(32),5,7,9,11(31),12,14,16,18,20,22(30),23,25,27-hexadecaene |
|---|---|
| PubChem CID | 11025931 |
| Molecular Formula | C32H24 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | pentacyclo[23.3.1.14,8.111,15.118,22]dotriaconta-1(29),2,4(32),5,7,9,11(31),12,14,16,18,20,22(30),23,25,27-hexadecaene |
| SMILES | C1=C\c2cccc(c2)/C=C\c2cccc(c2)/C=C\c2cccc(c2)/C=C\c2cccc/1c2 |
| InChI | InChI=1S/C32H24/c1-5-25-13-15-27-7-2-9-29(22-27)17-19-31-11-4-12-32(24-31)20-18-30-10-3-8-28(23-30)16-14-26(6-1)21-25/h1-24H/b15-13-,16-14-,19-17-,20-18- |
| InChIKey | QNBHDAYVKIUUBA-WLYXFYDPSA-N |
| XLogP | 8.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|