C17H22ClN5O2S — CID 110262982
3-[1-(2-chlorophenyl)sulfonylpyrrolidin-2-yl]-7-methyl-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepine (PubChem CID 110262982) has the molecular formula C17H22ClN5O2S and a molecular weight of 395.92 g/mol. Its IUPAC name is 3-[1-(2-chlorophenyl)sulfonylpyrrolidin-2-yl]-7-methyl-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepine.
| Compound Name | 3-[1-(2-chlorophenyl)sulfonylpyrrolidin-2-yl]-7-methyl-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepine |
|---|---|
| PubChem CID | 110262982 |
| Molecular Formula | C17H22ClN5O2S |
| Molecular Weight | 395.92 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 3-[1-(2-chlorophenyl)sulfonylpyrrolidin-2-yl]-7-methyl-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepine |
| SMILES | CN1CCc2nnc(C3CCCN3S(=O)(=O)c3ccccc3Cl)n2CC1 |
| InChI | InChI=1S/C17H22ClN5O2S/c1-21-10-8-16-19-20-17(22(16)12-11-21)14-6-4-9-23(14)26(24,25)15-7-3-2-5-13(15)18/h2-3,5,7,14H,4,6,8-12H2,1H3 |
| InChIKey | DJYVJSDXCGEGFR-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.92 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |