C17H20Cl2N4O2S — CID 97253238
3-[(2R)-1-(2,6-dichlorophenyl)sulfonylpiperidin-2-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 97253238) has the molecular formula C17H20Cl2N4O2S and a molecular weight of 415.35 g/mol. Its IUPAC name is 3-[(2R)-1-(2,6-dichlorophenyl)sulfonylpiperidin-2-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 3-[(2R)-1-(2,6-dichlorophenyl)sulfonylpiperidin-2-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 97253238 |
| Molecular Formula | C17H20Cl2N4O2S |
| Molecular Weight | 415.35 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | 3-[(2R)-1-(2,6-dichlorophenyl)sulfonylpiperidin-2-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | O=S(=O)(c1c(Cl)cccc1Cl)N1CCCC[C@@H]1c1nnc2n1CCCC2 |
| InChI | InChI=1S/C17H20Cl2N4O2S/c18-12-6-5-7-13(19)16(12)26(24,25)23-11-4-1-8-14(23)17-21-20-15-9-2-3-10-22(15)17/h5-7,14H,1-4,8-11H2/t14-/m1/s1 |
| InChIKey | WVGBPZJKSXDDRL-CQSZACIVSA-N |
| XLogP | 3.84 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.35 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |