C23H34N4O2S — CID 55487842
3-[1-(4-tert-butyl-2,6-dimethylphenyl)sulfonylpyrrolidin-2-yl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine (PubChem CID 55487842) has the molecular formula C23H34N4O2S and a molecular weight of 430.62 g/mol. Its IUPAC name is 3-[1-(4-tert-butyl-2,6-dimethylphenyl)sulfonylpyrrolidin-2-yl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine.
| Compound Name | 3-[1-(4-tert-butyl-2,6-dimethylphenyl)sulfonylpyrrolidin-2-yl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine |
|---|---|
| PubChem CID | 55487842 |
| Molecular Formula | C23H34N4O2S |
| Molecular Weight | 430.62 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | 3-[1-(4-tert-butyl-2,6-dimethylphenyl)sulfonylpyrrolidin-2-yl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine |
| SMILES | Cc1cc(C(C)(C)C)cc(C)c1S(=O)(=O)N1CCCC1c1nnc2n1CCCCC2 |
| InChI | InChI=1S/C23H34N4O2S/c1-16-14-18(23(3,4)5)15-17(2)21(16)30(28,29)27-13-9-10-19(27)22-25-24-20-11-7-6-8-12-26(20)22/h14-15,19H,6-13H2,1-5H3 |
| InChIKey | GLYKZMKFTACEHY-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.62 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |