C19H26N4O3S — CID 126809488
3-[1-(2-methoxy-5-methylphenyl)sulfonylpiperidin-2-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 126809488) has the molecular formula C19H26N4O3S and a molecular weight of 390.51 g/mol. Its IUPAC name is 3-[1-(2-methoxy-5-methylphenyl)sulfonylpiperidin-2-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 3-[1-(2-methoxy-5-methylphenyl)sulfonylpiperidin-2-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 126809488 |
| Molecular Formula | C19H26N4O3S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 3-[1-(2-methoxy-5-methylphenyl)sulfonylpiperidin-2-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | COc1ccc(C)cc1S(=O)(=O)N1CCCCC1c1nnc2n1CCCC2 |
| InChI | InChI=1S/C19H26N4O3S/c1-14-9-10-16(26-2)17(13-14)27(24,25)23-12-6-3-7-15(23)19-21-20-18-8-4-5-11-22(18)19/h9-10,13,15H,3-8,11-12H2,1-2H3 |
| InChIKey | OCMIJURCAQGRCN-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |