C17H21N3O4 — CID 110284340
2-[3-oxo-4-pent-4-enyl-1-(pyridine-3-carbonyl)piperazin-2-yl]acetic acid (PubChem CID 110284340) has the molecular formula C17H21N3O4 and a molecular weight of 331.37 g/mol. Its IUPAC name is 2-[3-oxo-4-pent-4-enyl-1-(pyridine-3-carbonyl)piperazin-2-yl]acetic acid.
| Compound Name | 2-[3-oxo-4-pent-4-enyl-1-(pyridine-3-carbonyl)piperazin-2-yl]acetic acid |
|---|---|
| PubChem CID | 110284340 |
| Molecular Formula | C17H21N3O4 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 2-[3-oxo-4-pent-4-enyl-1-(pyridine-3-carbonyl)piperazin-2-yl]acetic acid |
| SMILES | C=CCCCN1CCN(C(=O)c2cccnc2)C(CC(=O)O)C1=O |
| InChI | InChI=1S/C17H21N3O4/c1-2-3-4-8-19-9-10-20(14(17(19)24)11-15(21)22)16(23)13-6-5-7-18-12-13/h2,5-7,12,14H,1,3-4,8-11H2,(H,21,22) |
| InChIKey | LZSCECLEFFIYNA-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 90.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|