C21H20N2O3 — CID 146607210
(3S)-1,4-dibenzoyl-3-prop-2-enylpiperazin-2-one (PubChem CID 146607210) has the molecular formula C21H20N2O3 and a molecular weight of 348.40 g/mol. Its IUPAC name is (3S)-1,4-dibenzoyl-3-prop-2-enylpiperazin-2-one.
| Compound Name | (3S)-1,4-dibenzoyl-3-prop-2-enylpiperazin-2-one |
|---|---|
| PubChem CID | 146607210 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | (3S)-1,4-dibenzoyl-3-prop-2-enylpiperazin-2-one |
| SMILES | C=CC[C@H]1C(=O)N(C(=O)c2ccccc2)CCN1C(=O)c1ccccc1 |
| InChI | InChI=1S/C21H20N2O3/c1-2-9-18-21(26)23(20(25)17-12-7-4-8-13-17)15-14-22(18)19(24)16-10-5-3-6-11-16/h2-8,10-13,18H,1,9,14-15H2/t18-/m0/s1 |
| InChIKey | WKANIVTXZLPUMA-SFHVURJKSA-N |
| XLogP | 2.76 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|