C21H18N2O3 — CID 134942845
(4S,5S)-1,3-dibenzoyl-4,5-bis(ethenyl)imidazolidin-2-one (PubChem CID 134942845) has the molecular formula C21H18N2O3 and a molecular weight of 346.39 g/mol. Its IUPAC name is (4S,5S)-1,3-dibenzoyl-4,5-bis(ethenyl)imidazolidin-2-one.
| Compound Name | (4S,5S)-1,3-dibenzoyl-4,5-bis(ethenyl)imidazolidin-2-one |
|---|---|
| PubChem CID | 134942845 |
| Molecular Formula | C21H18N2O3 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | (4S,5S)-1,3-dibenzoyl-4,5-bis(ethenyl)imidazolidin-2-one |
| SMILES | C=C[C@H]1[C@H](C=C)N(C(=O)c2ccccc2)C(=O)N1C(=O)c1ccccc1 |
| InChI | InChI=1S/C21H18N2O3/c1-3-17-18(4-2)23(20(25)16-13-9-6-10-14-16)21(26)22(17)19(24)15-11-7-5-8-12-15/h3-14,17-18H,1-2H2/t17-,18-/m0/s1 |
| InChIKey | QBXXWIPKWDKIDK-ROUUACIJSA-N |
| XLogP | 3.51 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|