C16H19NO3 — CID 569780
3-benzoyl-2-tert-butyl-4-ethenyl-1,3-oxazolidin-5-one (PubChem CID 569780) has the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. Its IUPAC name is 3-benzoyl-2-tert-butyl-4-ethenyl-1,3-oxazolidin-5-one.
| Compound Name | 3-benzoyl-2-tert-butyl-4-ethenyl-1,3-oxazolidin-5-one |
|---|---|
| PubChem CID | 569780 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | 3-benzoyl-2-tert-butyl-4-ethenyl-1,3-oxazolidin-5-one |
| SMILES | C=CC1C(=O)OC(C(C)(C)C)N1C(=O)c1ccccc1 |
| InChI | InChI=1S/C16H19NO3/c1-5-12-14(19)20-15(16(2,3)4)17(12)13(18)11-9-7-6-8-10-11/h5-10,12,15H,1H2,2-4H3 |
| InChIKey | IBGZGPFVNBVWLI-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|