About hex-5-enoyl pyridine-3-carboxylate
hex-5-enoyl pyridine-3-carboxylate (PubChem CID 175156947) has the molecular formula C12H13NO3
and a molecular weight of 219.24 g/mol. Its IUPAC name is hex-5-enoyl pyridine-3-carboxylate.
Molecular Properties
| Compound Name | hex-5-enoyl pyridine-3-carboxylate |
| PubChem CID | 175156947 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | hex-5-enoyl pyridine-3-carboxylate |
| SMILES | C=CCCCC(=O)OC(=O)c1cccnc1 |
| InChI | InChI=1S/C12H13NO3/c1-2-3-4-7-11(14)16-12(15)10-6-5-8-13-9-10/h2,5-6,8-9H,1,3-4,7H2 |
| InChIKey | LKRGSCBQCXAEAS-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze hex-5-enoyl pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hex-5-enoyl pyridine-3-carboxylate?
The IUPAC name of hex-5-enoyl pyridine-3-carboxylate (CID 175156947) is hex-5-enoyl pyridine-3-carboxylate.
What is the SMILES notation for hex-5-enoyl pyridine-3-carboxylate?
The canonical SMILES for hex-5-enoyl pyridine-3-carboxylate is C=CCCCC(=O)OC(=O)c1cccnc1.
What is the InChIKey of hex-5-enoyl pyridine-3-carboxylate?
The InChIKey is LKRGSCBQCXAEAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO3/c1-2-3-4-7-11(14)16-12(15)10-6-5-8-13-9-10/h2,5-6,8-9H,1,3-4,7H2.
What are the key properties of hex-5-enoyl pyridine-3-carboxylate?
hex-5-enoyl pyridine-3-carboxylate has a molecular weight of 219.24 g/mol, XLogP of 2.12, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hex-5-enoyl pyridine-3-carboxylate is sourced from PubChem (CID 175156947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).