C12H11NO9 — CID 57477005
2-hydroperoxy-2-[2-oxo-2-(pyridine-3-carbonyloxy)ethyl]butanedioic acid (PubChem CID 57477005) has the molecular formula C12H11NO9 and a molecular weight of 313.22 g/mol. Its IUPAC name is 2-hydroperoxy-2-[2-oxo-2-(pyridine-3-carbonyloxy)ethyl]butanedioic acid.
| Compound Name | 2-hydroperoxy-2-[2-oxo-2-(pyridine-3-carbonyloxy)ethyl]butanedioic acid |
|---|---|
| PubChem CID | 57477005 |
| Molecular Formula | C12H11NO9 |
| Molecular Weight | 313.22 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | 2-hydroperoxy-2-[2-oxo-2-(pyridine-3-carbonyloxy)ethyl]butanedioic acid |
| SMILES | O=C(O)CC(CC(=O)OC(=O)c1cccnc1)(OO)C(=O)O |
| InChI | InChI=1S/C12H11NO9/c14-8(15)4-12(22-20,11(18)19)5-9(16)21-10(17)7-2-1-3-13-6-7/h1-3,6,20H,4-5H2,(H,14,15)(H,18,19) |
| InChIKey | ZJUWUPGZVCZBGX-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 160.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.22 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|