C12H9K2NO9 — CID 87838126
dipotassium;2-hydroperoxy-2-[2-oxo-2-(pyridine-3-carbonyloxy)ethyl]butanedioate (PubChem CID 87838126) has the molecular formula C12H9K2NO9 and a molecular weight of 389.40 g/mol. Its IUPAC name is dipotassium;2-hydroperoxy-2-[2-oxo-2-(pyridine-3-carbonyloxy)ethyl]butanedioate.
| Compound Name | dipotassium;2-hydroperoxy-2-[2-oxo-2-(pyridine-3-carbonyloxy)ethyl]butanedioate |
|---|---|
| PubChem CID | 87838126 |
| Molecular Formula | C12H9K2NO9 |
| Molecular Weight | 389.40 g/mol |
| Exact Mass | 388.96 |
| IUPAC Name | dipotassium;2-hydroperoxy-2-[2-oxo-2-(pyridine-3-carbonyloxy)ethyl]butanedioate |
| SMILES | O=C([O-])CC(CC(=O)OC(=O)c1cccnc1)(OO)C(=O)[O-].[K+].[K+] |
| InChI | InChI=1S/C12H11NO9.2K/c14-8(15)4-12(22-20,11(18)19)5-9(16)21-10(17)7-2-1-3-13-6-7;;/h1-3,6,20H,4-5H2,(H,14,15)(H,18,19);;/q;2*+1/p-2 |
| InChIKey | RUTPDVMBABUINJ-UHFFFAOYSA-L |
| XLogP | -8.72 |
| TPSA | 165.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.40 |
| LogP ≤ 5 | -8.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|