C5H8N6 — CID 11030015
6,7-dihydro-3H-purine-2,6-diamine (PubChem CID 11030015) has the molecular formula C5H8N6 and a molecular weight of 152.16 g/mol. Its IUPAC name is 6,7-dihydro-3H-purine-2,6-diamine.
| Compound Name | 6,7-dihydro-3H-purine-2,6-diamine |
|---|---|
| PubChem CID | 11030015 |
| Molecular Formula | C5H8N6 |
| Molecular Weight | 152.16 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | 6,7-dihydro-3H-purine-2,6-diamine |
| SMILES | NC1=NC(N)c2[nH]cnc2N1 |
| InChI | InChI=1S/C5H8N6/c6-3-2-4(9-1-8-2)11-5(7)10-3/h1,3H,6H2,(H,8,9)(H3,7,10,11) |
| InChIKey | VMBIKMLKDBHIRB-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 105.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.16 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |