C16H32N2O4S — CID 110307436
tert-butyl N-[(2S)-1-(cyclopentylsulfonylamino)-4-methylpentan-2-yl]carbamate (PubChem CID 110307436) has the molecular formula C16H32N2O4S and a molecular weight of 348.51 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-(cyclopentylsulfonylamino)-4-methylpentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-(cyclopentylsulfonylamino)-4-methylpentan-2-yl]carbamate |
|---|---|
| PubChem CID | 110307436 |
| Molecular Formula | C16H32N2O4S |
| Molecular Weight | 348.51 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | tert-butyl N-[(2S)-1-(cyclopentylsulfonylamino)-4-methylpentan-2-yl]carbamate |
| SMILES | CC(C)C[C@@H](CNS(=O)(=O)C1CCCC1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H32N2O4S/c1-12(2)10-13(18-15(19)22-16(3,4)5)11-17-23(20,21)14-8-6-7-9-14/h12-14,17H,6-11H2,1-5H3,(H,18,19)/t13-/m0/s1 |
| InChIKey | UHAUXHSDMUSOBE-ZDUSSCGKSA-N |
| XLogP | 2.79 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.51 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |