C18H23FN2OS — CID 110313528
3-(4-fluorophenyl)-N-[3-methyl-1-(1,3-thiazol-2-yl)butyl]butanamide (PubChem CID 110313528) has the molecular formula C18H23FN2OS and a molecular weight of 334.46 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N-[3-methyl-1-(1,3-thiazol-2-yl)butyl]butanamide.
| Compound Name | 3-(4-fluorophenyl)-N-[3-methyl-1-(1,3-thiazol-2-yl)butyl]butanamide |
|---|---|
| PubChem CID | 110313528 |
| Molecular Formula | C18H23FN2OS |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 3-(4-fluorophenyl)-N-[3-methyl-1-(1,3-thiazol-2-yl)butyl]butanamide |
| SMILES | CC(C)CC(NC(=O)CC(C)c1ccc(F)cc1)c1nccs1 |
| InChI | InChI=1S/C18H23FN2OS/c1-12(2)10-16(18-20-8-9-23-18)21-17(22)11-13(3)14-4-6-15(19)7-5-14/h4-9,12-13,16H,10-11H2,1-3H3,(H,21,22) |
| InChIKey | WCVZBVOMBRSFHW-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |