C15H14O2 — CID 11031555
(1S,5S)-7-(2-phenylethoxy)bicyclo[3.2.0]hepta-3,6-dien-2-one (PubChem CID 11031555) has the molecular formula C15H14O2 and a molecular weight of 226.27 g/mol. Its IUPAC name is (1S,5S)-7-(2-phenylethoxy)bicyclo[3.2.0]hepta-3,6-dien-2-one.
| Compound Name | (1S,5S)-7-(2-phenylethoxy)bicyclo[3.2.0]hepta-3,6-dien-2-one |
|---|---|
| PubChem CID | 11031555 |
| Molecular Formula | C15H14O2 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | (1S,5S)-7-(2-phenylethoxy)bicyclo[3.2.0]hepta-3,6-dien-2-one |
| SMILES | O=C1C=C[C@H]2C=C(OCCc3ccccc3)[C@@H]12 |
| InChI | InChI=1S/C15H14O2/c16-13-7-6-12-10-14(15(12)13)17-9-8-11-4-2-1-3-5-11/h1-7,10,12,15H,8-9H2/t12-,15+/m0/s1 |
| InChIKey | PFTULASHYRLSAL-SWLSCSKDSA-N |
| XLogP | 2.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |