C19H19NO2 — CID 137492079
(2S)-2-benzyl-3-(2-phenylethoxy)-1,2-dihydropyrrol-5-one (PubChem CID 137492079) has the molecular formula C19H19NO2 and a molecular weight of 293.37 g/mol. Its IUPAC name is (2S)-2-benzyl-3-(2-phenylethoxy)-1,2-dihydropyrrol-5-one.
| Compound Name | (2S)-2-benzyl-3-(2-phenylethoxy)-1,2-dihydropyrrol-5-one |
|---|---|
| PubChem CID | 137492079 |
| Molecular Formula | C19H19NO2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | (2S)-2-benzyl-3-(2-phenylethoxy)-1,2-dihydropyrrol-5-one |
| SMILES | O=C1C=C(OCCc2ccccc2)[C@H](Cc2ccccc2)N1 |
| InChI | InChI=1S/C19H19NO2/c21-19-14-18(22-12-11-15-7-3-1-4-8-15)17(20-19)13-16-9-5-2-6-10-16/h1-10,14,17H,11-13H2,(H,20,21)/t17-/m0/s1 |
| InChIKey | VHXDHGUUULYEPE-KRWDZBQOSA-N |
| XLogP | 2.87 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |