About [(2S)-2-benzyl-5-oxo-1,2-dihydropyrrol-3-yl] benzoate
[(2S)-2-benzyl-5-oxo-1,2-dihydropyrrol-3-yl] benzoate (PubChem CID 57414043) has the molecular formula C18H15NO3
and a molecular weight of 293.32 g/mol. Its IUPAC name is [(2S)-2-benzyl-5-oxo-1,2-dihydropyrrol-3-yl] benzoate.
Molecular Properties
| Compound Name | [(2S)-2-benzyl-5-oxo-1,2-dihydropyrrol-3-yl] benzoate |
| PubChem CID | 57414043 |
| Molecular Formula | C18H15NO3 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | [(2S)-2-benzyl-5-oxo-1,2-dihydropyrrol-3-yl] benzoate |
| SMILES | O=C1C=C(OC(=O)c2ccccc2)[C@H](Cc2ccccc2)N1 |
| InChI | InChI=1S/C18H15NO3/c20-17-12-16(22-18(21)14-9-5-2-6-10-14)15(19-17)11-13-7-3-1-4-8-13/h1-10,12,15H,11H2,(H,19,20)/t15-/m0/s1 |
| InChIKey | SEABSCFWSQMPAW-HNNXBMFYSA-N |
| XLogP | 2.47 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(2S)-2-benzyl-5-oxo-1,2-dihydropyrrol-3-yl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-2-benzyl-5-oxo-1,2-dihydropyrrol-3-yl] benzoate?
The IUPAC name of [(2S)-2-benzyl-5-oxo-1,2-dihydropyrrol-3-yl] benzoate (CID 57414043) is [(2S)-2-benzyl-5-oxo-1,2-dihydropyrrol-3-yl] benzoate.
What is the SMILES notation for [(2S)-2-benzyl-5-oxo-1,2-dihydropyrrol-3-yl] benzoate?
The canonical SMILES for [(2S)-2-benzyl-5-oxo-1,2-dihydropyrrol-3-yl] benzoate is O=C1C=C(OC(=O)c2ccccc2)[C@H](Cc2ccccc2)N1.
What is the InChIKey of [(2S)-2-benzyl-5-oxo-1,2-dihydropyrrol-3-yl] benzoate?
The InChIKey is SEABSCFWSQMPAW-HNNXBMFYSA-N. The full InChI is InChI=1S/C18H15NO3/c20-17-12-16(22-18(21)14-9-5-2-6-10-14)15(19-17)11-13-7-3-1-4-8-13/h1-10,12,15H,11H2,(H,19,20)/t15-/m0/s1.
What are the key properties of [(2S)-2-benzyl-5-oxo-1,2-dihydropyrrol-3-yl] benzoate?
[(2S)-2-benzyl-5-oxo-1,2-dihydropyrrol-3-yl] benzoate has a molecular weight of 293.32 g/mol, XLogP of 2.47, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-2-benzyl-5-oxo-1,2-dihydropyrrol-3-yl] benzoate is sourced from PubChem (CID 57414043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).