C18H15NO3 — CID 57414043
[(2S)-2-benzyl-5-oxo-1,2-dihydropyrrol-3-yl] benzoate (PubChem CID 57414043) has the molecular formula C18H15NO3 and a molecular weight of 293.32 g/mol. Its IUPAC name is [(2S)-2-benzyl-5-oxo-1,2-dihydropyrrol-3-yl] benzoate.
| Compound Name | [(2S)-2-benzyl-5-oxo-1,2-dihydropyrrol-3-yl] benzoate |
|---|---|
| PubChem CID | 57414043 |
| Molecular Formula | C18H15NO3 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | [(2S)-2-benzyl-5-oxo-1,2-dihydropyrrol-3-yl] benzoate |
| SMILES | O=C1C=C(OC(=O)c2ccccc2)[C@H](Cc2ccccc2)N1 |
| InChI | InChI=1S/C18H15NO3/c20-17-12-16(22-18(21)14-9-5-2-6-10-14)15(19-17)11-13-7-3-1-4-8-13/h1-10,12,15H,11H2,(H,19,20)/t15-/m0/s1 |
| InChIKey | SEABSCFWSQMPAW-HNNXBMFYSA-N |
| XLogP | 2.47 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |