C18H19ClN2O2S — CID 110316401
2-(3-chlorophenyl)sulfonyl-3-phenyl-1,3,5,6,7,7a-hexahydropyrrolo[1,2-c]imidazole (PubChem CID 110316401) has the molecular formula C18H19ClN2O2S and a molecular weight of 362.88 g/mol. Its IUPAC name is 2-(3-chlorophenyl)sulfonyl-3-phenyl-1,3,5,6,7,7a-hexahydropyrrolo[1,2-c]imidazole.
| Compound Name | 2-(3-chlorophenyl)sulfonyl-3-phenyl-1,3,5,6,7,7a-hexahydropyrrolo[1,2-c]imidazole |
|---|---|
| PubChem CID | 110316401 |
| Molecular Formula | C18H19ClN2O2S |
| Molecular Weight | 362.88 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | 2-(3-chlorophenyl)sulfonyl-3-phenyl-1,3,5,6,7,7a-hexahydropyrrolo[1,2-c]imidazole |
| SMILES | O=S(=O)(c1cccc(Cl)c1)N1CC2CCCN2C1c1ccccc1 |
| InChI | InChI=1S/C18H19ClN2O2S/c19-15-8-4-10-17(12-15)24(22,23)21-13-16-9-5-11-20(16)18(21)14-6-2-1-3-7-14/h1-4,6-8,10,12,16,18H,5,9,11,13H2 |
| InChIKey | GQOBEKSAYVBVQU-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.88 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |