C14H20OS — CID 11031888
(2S,3R)-2-butyl-3-[(1R)-1-phenylsulfanylethyl]oxirane (PubChem CID 11031888) has the molecular formula C14H20OS and a molecular weight of 236.38 g/mol. Its IUPAC name is (2S,3R)-2-butyl-3-[(1R)-1-phenylsulfanylethyl]oxirane.
| Compound Name | (2S,3R)-2-butyl-3-[(1R)-1-phenylsulfanylethyl]oxirane |
|---|---|
| PubChem CID | 11031888 |
| Molecular Formula | C14H20OS |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | (2S,3R)-2-butyl-3-[(1R)-1-phenylsulfanylethyl]oxirane |
| SMILES | CCCC[C@@H]1O[C@H]1[C@@H](C)Sc1ccccc1 |
| InChI | InChI=1S/C14H20OS/c1-3-4-10-13-14(15-13)11(2)16-12-8-6-5-7-9-12/h5-9,11,13-14H,3-4,10H2,1-2H3/t11-,13+,14+/m1/s1 |
| InChIKey | JDTOYWMGMOSDPO-XBFCOCLRSA-N |
| XLogP | 4.12 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|