C19H23N3O2S — CID 110322492
N-[2-(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)ethyl]adamantane-1-carboxamide (PubChem CID 110322492) has the molecular formula C19H23N3O2S and a molecular weight of 357.48 g/mol. Its IUPAC name is N-[2-(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)ethyl]adamantane-1-carboxamide.
| Compound Name | N-[2-(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)ethyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 110322492 |
| Molecular Formula | C19H23N3O2S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | N-[2-(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)ethyl]adamantane-1-carboxamide |
| SMILES | O=C(NCCc1nnc(-c2cccs2)o1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C19H23N3O2S/c23-18(19-9-12-6-13(10-19)8-14(7-12)11-19)20-4-3-16-21-22-17(24-16)15-2-1-5-25-15/h1-2,5,12-14H,3-4,6-11H2,(H,20,23) |
| InChIKey | UYWKWJYOTQHMAV-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |