C18H19ClN2O3S — CID 154755442
(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl 3-chloroadamantane-1-carboxylate (PubChem CID 154755442) has the molecular formula C18H19ClN2O3S and a molecular weight of 378.88 g/mol. Its IUPAC name is (5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl 3-chloroadamantane-1-carboxylate.
| Compound Name | (5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl 3-chloroadamantane-1-carboxylate |
|---|---|
| PubChem CID | 154755442 |
| Molecular Formula | C18H19ClN2O3S |
| Molecular Weight | 378.88 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | (5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl 3-chloroadamantane-1-carboxylate |
| SMILES | O=C(OCc1nnc(-c2cccs2)o1)C12CC3CC(CC(Cl)(C3)C1)C2 |
| InChI | InChI=1S/C18H19ClN2O3S/c19-18-7-11-4-12(8-18)6-17(5-11,10-18)16(22)23-9-14-20-21-15(24-14)13-2-1-3-25-13/h1-3,11-12H,4-10H2 |
| InChIKey | XUCIENMQQQMXSE-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.88 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|