C17H20N2O5S — CID 110343621
N-(furan-2-ylmethyl)-3-(2-methylmorpholin-4-yl)sulfonylbenzamide (PubChem CID 110343621) has the molecular formula C17H20N2O5S and a molecular weight of 364.42 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-3-(2-methylmorpholin-4-yl)sulfonylbenzamide.
| Compound Name | N-(furan-2-ylmethyl)-3-(2-methylmorpholin-4-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 110343621 |
| Molecular Formula | C17H20N2O5S |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | N-(furan-2-ylmethyl)-3-(2-methylmorpholin-4-yl)sulfonylbenzamide |
| SMILES | CC1CN(S(=O)(=O)c2cccc(C(=O)NCc3ccco3)c2)CCO1 |
| InChI | InChI=1S/C17H20N2O5S/c1-13-12-19(7-9-23-13)25(21,22)16-6-2-4-14(10-16)17(20)18-11-15-5-3-8-24-15/h2-6,8,10,13H,7,9,11-12H2,1H3,(H,18,20) |
| InChIKey | QCKRNFSHHIFVGD-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |