C16H18N2O5 — CID 110344679
4-oxo-4-(2-oxo-3H-1,3-benzoxazol-6-yl)-N-(oxolan-2-ylmethyl)butanamide (PubChem CID 110344679) has the molecular formula C16H18N2O5 and a molecular weight of 318.33 g/mol. Its IUPAC name is 4-oxo-4-(2-oxo-3H-1,3-benzoxazol-6-yl)-N-(oxolan-2-ylmethyl)butanamide.
| Compound Name | 4-oxo-4-(2-oxo-3H-1,3-benzoxazol-6-yl)-N-(oxolan-2-ylmethyl)butanamide |
|---|---|
| PubChem CID | 110344679 |
| Molecular Formula | C16H18N2O5 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 4-oxo-4-(2-oxo-3H-1,3-benzoxazol-6-yl)-N-(oxolan-2-ylmethyl)butanamide |
| SMILES | O=C(CCC(=O)c1ccc2[nH]c(=O)oc2c1)NCC1CCCO1 |
| InChI | InChI=1S/C16H18N2O5/c19-13(5-6-15(20)17-9-11-2-1-7-22-11)10-3-4-12-14(8-10)23-16(21)18-12/h3-4,8,11H,1-2,5-7,9H2,(H,17,20)(H,18,21) |
| InChIKey | CNWVJRHDNVSHLB-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 101.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |