C18H22N2O3 — CID 53174855
3-(7-methyl-2-oxo-1H-quinolin-3-yl)-N-(oxolan-2-ylmethyl)propanamide (PubChem CID 53174855) has the molecular formula C18H22N2O3 and a molecular weight of 314.38 g/mol. Its IUPAC name is 3-(7-methyl-2-oxo-1H-quinolin-3-yl)-N-(oxolan-2-ylmethyl)propanamide.
| Compound Name | 3-(7-methyl-2-oxo-1H-quinolin-3-yl)-N-(oxolan-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 53174855 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 3-(7-methyl-2-oxo-1H-quinolin-3-yl)-N-(oxolan-2-ylmethyl)propanamide |
| SMILES | Cc1ccc2cc(CCC(=O)NCC3CCCO3)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C18H22N2O3/c1-12-4-5-13-10-14(18(22)20-16(13)9-12)6-7-17(21)19-11-15-3-2-8-23-15/h4-5,9-10,15H,2-3,6-8,11H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | ZERXAJRDOQLREL-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |