C14H19ClN4O2S2 — CID 110357242
6-chloro-N-[[4-(diethylaminomethyl)-1,3-thiazol-2-yl]methyl]pyridine-3-sulfonamide (PubChem CID 110357242) has the molecular formula C14H19ClN4O2S2 and a molecular weight of 374.92 g/mol. Its IUPAC name is 6-chloro-N-[[4-(diethylaminomethyl)-1,3-thiazol-2-yl]methyl]pyridine-3-sulfonamide.
| Compound Name | 6-chloro-N-[[4-(diethylaminomethyl)-1,3-thiazol-2-yl]methyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 110357242 |
| Molecular Formula | C14H19ClN4O2S2 |
| Molecular Weight | 374.92 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | 6-chloro-N-[[4-(diethylaminomethyl)-1,3-thiazol-2-yl]methyl]pyridine-3-sulfonamide |
| SMILES | CCN(CC)Cc1csc(CNS(=O)(=O)c2ccc(Cl)nc2)n1 |
| InChI | InChI=1S/C14H19ClN4O2S2/c1-3-19(4-2)9-11-10-22-14(18-11)8-17-23(20,21)12-5-6-13(15)16-7-12/h5-7,10,17H,3-4,8-9H2,1-2H3 |
| InChIKey | UADYWWPZCUJAHX-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.92 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|