C24H21N3O3 — CID 110358074
7-[4-(3-phenylbenzoyl)piperazin-1-yl]-3H-1,3-benzoxazol-2-one (PubChem CID 110358074) has the molecular formula C24H21N3O3 and a molecular weight of 399.45 g/mol. Its IUPAC name is 7-[4-(3-phenylbenzoyl)piperazin-1-yl]-3H-1,3-benzoxazol-2-one.
| Compound Name | 7-[4-(3-phenylbenzoyl)piperazin-1-yl]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 110358074 |
| Molecular Formula | C24H21N3O3 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 7-[4-(3-phenylbenzoyl)piperazin-1-yl]-3H-1,3-benzoxazol-2-one |
| SMILES | O=C(c1cccc(-c2ccccc2)c1)N1CCN(c2cccc3[nH]c(=O)oc23)CC1 |
| InChI | InChI=1S/C24H21N3O3/c28-23(19-9-4-8-18(16-19)17-6-2-1-3-7-17)27-14-12-26(13-15-27)21-11-5-10-20-22(21)30-24(29)25-20/h1-11,16H,12-15H2,(H,25,29) |
| InChIKey | OVEWHGOBHWZFTO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 69.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |