C33H36F3N3O2 — CID 11039028
9-[4-[3-(benzamidomethyl)piperidin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide (PubChem CID 11039028) has the molecular formula C33H36F3N3O2 and a molecular weight of 563.66 g/mol. Its IUPAC name is 9-[4-[3-(benzamidomethyl)piperidin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide.
| Compound Name | 9-[4-[3-(benzamidomethyl)piperidin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
|---|---|
| PubChem CID | 11039028 |
| Molecular Formula | C33H36F3N3O2 |
| Molecular Weight | 563.66 g/mol |
| Exact Mass | 563.28 |
| IUPAC Name | 9-[4-[3-(benzamidomethyl)piperidin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
| SMILES | O=C(NCC1CCCN(CCCCC2(C(=O)NCC(F)(F)F)c3ccccc3-c3ccccc32)C1)c1ccccc1 |
| InChI | InChI=1S/C33H36F3N3O2/c34-33(35,36)23-38-31(41)32(28-16-6-4-14-26(28)27-15-5-7-17-29(27)32)18-8-9-19-39-20-10-11-24(22-39)21-37-30(40)25-12-2-1-3-13-25/h1-7,12-17,24H,8-11,18-23H2,(H,37,40)(H,38,41) |
| InChIKey | NBIAZLSUXMXZIJ-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.66 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|