C34H62O4Si2 — CID 11039220
1-[(3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(1S,2E)-1-methoxy-4-tri(propan-2-yl)silyloxypenta-2,4-dienyl]-2,6,6-trimethylcyclohexen-1-yl]but-3-en-2-one (PubChem CID 11039220) has the molecular formula C34H62O4Si2 and a molecular weight of 591.04 g/mol. Its IUPAC name is 1-[(3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(1S,2E)-1-methoxy-4-tri(propan-2-yl)silyloxypenta-2,4-dienyl]-2,6,6-trimethylcyclohexen-1-yl]but-3-en-2-one.
| Compound Name | 1-[(3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(1S,2E)-1-methoxy-4-tri(propan-2-yl)silyloxypenta-2,4-dienyl]-2,6,6-trimethylcyclohexen-1-yl]but-3-en-2-one |
|---|---|
| PubChem CID | 11039220 |
| Molecular Formula | C34H62O4Si2 |
| Molecular Weight | 591.04 g/mol |
| Exact Mass | 590.42 |
| IUPAC Name | 1-[(3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(1S,2E)-1-methoxy-4-tri(propan-2-yl)silyloxypenta-2,4-dienyl]-2,6,6-trimethylcyclohexen-1-yl]but-3-en-2-one |
| SMILES | C=CC(=O)CC1=C(C)[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H]([C@H](/C=C/C(=C)O[Si](C(C)C)(C(C)C)C(C)C)OC)C1(C)C |
| InChI | InChI=1S/C34H62O4Si2/c1-18-28(35)21-29-27(9)32(38-39(16,17)33(10,11)12)22-30(34(29,13)14)31(36-15)20-19-26(8)37-40(23(2)3,24(4)5)25(6)7/h18-20,23-25,30-32H,1,8,21-22H2,2-7,9-17H3/b20-19+/t30-,31-,32-/m0/s1 |
| InChIKey | MXNKURZBVQEMCL-ZDPBEVGESA-N |
| XLogP | 10.16 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.04 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|