C17H23FN2O2 — CID 110394813
N,N-diethyl-3-(4-fluorobenzoyl)piperidine-1-carboxamide (PubChem CID 110394813) has the molecular formula C17H23FN2O2 and a molecular weight of 306.38 g/mol. Its IUPAC name is N,N-diethyl-3-(4-fluorobenzoyl)piperidine-1-carboxamide.
| Compound Name | N,N-diethyl-3-(4-fluorobenzoyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 110394813 |
| Molecular Formula | C17H23FN2O2 |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | N,N-diethyl-3-(4-fluorobenzoyl)piperidine-1-carboxamide |
| SMILES | CCN(CC)C(=O)N1CCCC(C(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C17H23FN2O2/c1-3-19(4-2)17(22)20-11-5-6-14(12-20)16(21)13-7-9-15(18)10-8-13/h7-10,14H,3-6,11-12H2,1-2H3 |
| InChIKey | QYEXONYAIDQRMH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |