C14H18F3N3O3S — CID 110397603
2,3,4-trifluoro-N-[2-(4-methylsulfonylpiperazin-1-yl)ethyl]benzamide (PubChem CID 110397603) has the molecular formula C14H18F3N3O3S and a molecular weight of 365.38 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-[2-(4-methylsulfonylpiperazin-1-yl)ethyl]benzamide.
| Compound Name | 2,3,4-trifluoro-N-[2-(4-methylsulfonylpiperazin-1-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 110397603 |
| Molecular Formula | C14H18F3N3O3S |
| Molecular Weight | 365.38 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 2,3,4-trifluoro-N-[2-(4-methylsulfonylpiperazin-1-yl)ethyl]benzamide |
| SMILES | CS(=O)(=O)N1CCN(CCNC(=O)c2ccc(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C14H18F3N3O3S/c1-24(22,23)20-8-6-19(7-9-20)5-4-18-14(21)10-2-3-11(15)13(17)12(10)16/h2-3H,4-9H2,1H3,(H,18,21) |
| InChIKey | KKCXZAUDTXZKLQ-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.38 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|