C8H15NO3 — CID 110398473
N-[2-(1,3-dioxan-2-yl)ethyl]acetamide (PubChem CID 110398473) has the molecular formula C8H15NO3 and a molecular weight of 173.21 g/mol. Its IUPAC name is N-[2-(1,3-dioxan-2-yl)ethyl]acetamide.
| Compound Name | N-[2-(1,3-dioxan-2-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 110398473 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | N-[2-(1,3-dioxan-2-yl)ethyl]acetamide |
| SMILES | CC(=O)NCCC1OCCCO1 |
| InChI | InChI=1S/C8H15NO3/c1-7(10)9-4-3-8-11-5-2-6-12-8/h8H,2-6H2,1H3,(H,9,10) |
| InChIKey | KORDFZITWIXAFK-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |