C9H17NO3 — CID 141007817
2-methyl-N-propyl-1,3-dioxane-5-carboxamide (PubChem CID 141007817) has the molecular formula C9H17NO3 and a molecular weight of 187.24 g/mol. Its IUPAC name is 2-methyl-N-propyl-1,3-dioxane-5-carboxamide.
| Compound Name | 2-methyl-N-propyl-1,3-dioxane-5-carboxamide |
|---|---|
| PubChem CID | 141007817 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | 2-methyl-N-propyl-1,3-dioxane-5-carboxamide |
| SMILES | CCCNC(=O)C1COC(C)OC1 |
| InChI | InChI=1S/C9H17NO3/c1-3-4-10-9(11)8-5-12-7(2)13-6-8/h7-8H,3-6H2,1-2H3,(H,10,11) |
| InChIKey | YUMOHKNHPJTSMV-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |