C10H19NO4 — CID 141007804
N-(3-methoxypropyl)-2-methyl-1,3-dioxane-5-carboxamide (PubChem CID 141007804) has the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. Its IUPAC name is N-(3-methoxypropyl)-2-methyl-1,3-dioxane-5-carboxamide.
| Compound Name | N-(3-methoxypropyl)-2-methyl-1,3-dioxane-5-carboxamide |
|---|---|
| PubChem CID | 141007804 |
| Molecular Formula | C10H19NO4 |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | N-(3-methoxypropyl)-2-methyl-1,3-dioxane-5-carboxamide |
| SMILES | COCCCNC(=O)C1COC(C)OC1 |
| InChI | InChI=1S/C10H19NO4/c1-8-14-6-9(7-15-8)10(12)11-4-3-5-13-2/h8-9H,3-7H2,1-2H3,(H,11,12) |
| InChIKey | DQKVTROSEMTHGB-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|